C13H20IN3O2S — CID 111344708
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111344708) has the molecular formula C13H20IN3O2S and a molecular weight of 409.29 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111344708 |
| Molecular Formula | C13H20IN3O2S |
| Molecular Weight | 409.29 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSC)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C13H19N3O2S.HI/c1-14-13(15-5-6-19-2)16-8-10-3-4-11-12(7-10)18-9-17-11;/h3-4,7H,5-6,8-9H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | ILHHGLBXBDNGOZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|