C16H26IN3O2 — CID 111843675
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide (PubChem CID 111843675) has the molecular formula C16H26IN3O2 and a molecular weight of 419.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111843675 |
| Molecular Formula | C16H26IN3O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(4-methylpentyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCC(C)C)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C16H25N3O2.HI/c1-12(2)5-4-8-18-16(17-3)19-10-13-6-7-14-15(9-13)21-11-20-14;/h6-7,9,12H,4-5,8,10-11H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | OHIIOUSLKNLTMK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|