C16H26IN3O4S — CID 111573796
1-(1,3-benzodioxol-5-ylmethyl)-3-(2-tert-butylsulfonylethyl)-2-methylguanidine;hydroiodide (PubChem CID 111573796) has the molecular formula C16H26IN3O4S and a molecular weight of 483.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(2-tert-butylsulfonylethyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(2-tert-butylsulfonylethyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111573796 |
| Molecular Formula | C16H26IN3O4S |
| Molecular Weight | 483.37 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(2-tert-butylsulfonylethyl)-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)C(C)(C)C)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C16H25N3O4S.HI/c1-16(2,3)24(20,21)8-7-18-15(17-4)19-10-12-5-6-13-14(9-12)23-11-22-13;/h5-6,9H,7-8,10-11H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | PWVSXGZPFFNBLC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|