C21H28N4O4S — CID 111845867
1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111845867) has the molecular formula C21H28N4O4S and a molecular weight of 432.55 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111845867 |
| Molecular Formula | C21H28N4O4S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[[2-(tert-butylsulfamoyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1ccc2c(c1)OCO2)NCc1ccccc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H28N4O4S/c1-21(2,3)25-30(26,27)19-8-6-5-7-16(19)13-24-20(22-4)23-12-15-9-10-17-18(11-15)29-14-28-17/h5-11,25H,12-14H2,1-4H3,(H2,22,23,24) |
| InChIKey | BMVUIYVCOYMISH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|