C17H19IN4O4 — CID 111843869
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111843869) has the molecular formula C17H19IN4O4 and a molecular weight of 470.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111843869 |
| Molecular Formula | C17H19IN4O4 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[(2-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc2c(c1)OCO2)NCc1ccccc1[N+](=O)[O-].I |
| InChI | InChI=1S/C17H18N4O4.HI/c1-18-17(20-10-13-4-2-3-5-14(13)21(22)23)19-9-12-6-7-15-16(8-12)25-11-24-15;/h2-8H,9-11H2,1H3,(H2,18,19,20);1H |
| InChIKey | JDOHMMXGJLYCMO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|