C19H24IN5O4 — CID 111379646
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide (PubChem CID 111379646) has the molecular formula C19H24IN5O4 and a molecular weight of 513.34 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111379646 |
| Molecular Formula | C19H24IN5O4 |
| Molecular Weight | 513.34 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[2-(2-nitroanilino)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCNc1ccccc1[N+](=O)[O-])NCCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C19H23N5O4.HI/c1-20-19(22-9-8-14-6-7-17-18(12-14)28-13-27-17)23-11-10-21-15-4-2-3-5-16(15)24(25)26;/h2-7,12,21H,8-11,13H2,1H3,(H2,20,22,23);1H |
| InChIKey | ACBZZDWMONDHQS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|