C21H25N7O2 — CID 111850452
2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine (PubChem CID 111850452) has the molecular formula C21H25N7O2 and a molecular weight of 407.48 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine.
| Compound Name | 2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111850452 |
| Molecular Formula | C21H25N7O2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-methyl-1-[2-(2-nitroanilino)ethyl]-3-[2-(4-pyrazol-1-ylphenyl)ethyl]guanidine |
| SMILES | C/N=C(/NCCNc1ccccc1[N+](=O)[O-])NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C21H25N7O2/c1-22-21(25-15-14-23-19-5-2-3-6-20(19)28(29)30)24-13-11-17-7-9-18(10-8-17)27-16-4-12-26-27/h2-10,12,16,23H,11,13-15H2,1H3,(H2,22,24,25) |
| InChIKey | PLFRIUYPAGBUFE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|