C20H27IN6O3 — CID 111633128
N-methyl-3-[2-[[N'-methyl-N-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111633128) has the molecular formula C20H27IN6O3 and a molecular weight of 526.38 g/mol. Its IUPAC name is N-methyl-3-[2-[[N'-methyl-N-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | N-methyl-3-[2-[[N'-methyl-N-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111633128 |
| Molecular Formula | C20H27IN6O3 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | N-methyl-3-[2-[[N'-methyl-N-[2-(2-nitroanilino)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(/NCCNc1ccccc1[N+](=O)[O-])NCCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C20H26N6O3.HI/c1-21-19(27)16-7-5-6-15(14-16)10-11-24-20(22-2)25-13-12-23-17-8-3-4-9-18(17)26(28)29;/h3-9,14,23H,10-13H2,1-2H3,(H,21,27)(H2,22,24,25);1H |
| InChIKey | RRMRKWFOUUMREP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|