C20H27IN4OS — CID 111631805
N-methyl-3-[2-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111631805) has the molecular formula C20H27IN4OS and a molecular weight of 498.43 g/mol. Its IUPAC name is N-methyl-3-[2-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | N-methyl-3-[2-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111631805 |
| Molecular Formula | C20H27IN4OS |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N-methyl-3-[2-[[N'-methyl-N-(2-phenylsulfanylethyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCSc1ccccc1)NCCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C20H26N4OS.HI/c1-21-19(25)17-8-6-7-16(15-17)11-12-23-20(22-2)24-13-14-26-18-9-4-3-5-10-18;/h3-10,15H,11-14H2,1-2H3,(H,21,25)(H2,22,23,24);1H |
| InChIKey | SRMNENAHBRCTJH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|