C21H29IN4OS — CID 111632025
N-methyl-3-[2-[[N'-methyl-N-(3-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111632025) has the molecular formula C21H29IN4OS and a molecular weight of 512.46 g/mol. Its IUPAC name is N-methyl-3-[2-[[N'-methyl-N-(3-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | N-methyl-3-[2-[[N'-methyl-N-(3-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111632025 |
| Molecular Formula | C21H29IN4OS |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | N-methyl-3-[2-[[N'-methyl-N-(3-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCCSc1ccccc1)NCCc1cccc(C(=O)NC)c1.I |
| InChI | InChI=1S/C21H28N4OS.HI/c1-22-20(26)18-9-6-8-17(16-18)12-14-25-21(23-2)24-13-7-15-27-19-10-4-3-5-11-19;/h3-6,8-11,16H,7,12-15H2,1-2H3,(H,22,26)(H2,23,24,25);1H |
| InChIKey | HHGDVWFETZVLRG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|