C22H30N4OS — CID 111669158
N,N-dimethyl-3-[2-[[N'-methyl-N-(3-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111669158) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[[N'-methyl-N-(3-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N,N-dimethyl-3-[2-[[N'-methyl-N-(3-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111669158 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | N,N-dimethyl-3-[2-[[N'-methyl-N-(3-phenylsulfanylpropyl)carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(\NCCCSc1ccccc1)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C22H30N4OS/c1-23-22(24-14-8-16-28-20-11-5-4-6-12-20)25-15-13-18-9-7-10-19(17-18)21(27)26(2)3/h4-7,9-12,17H,8,13-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | QOYWENOUEKLSJI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|