C19H32N4O2 — CID 111669742
3-[2-[[N-(5-methoxypentyl)-N'-methylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide (PubChem CID 111669742) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 3-[2-[[N-(5-methoxypentyl)-N'-methylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-[[N-(5-methoxypentyl)-N'-methylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111669742 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 3-[2-[[N-(5-methoxypentyl)-N'-methylcarbamimidoyl]amino]ethyl]-N,N-dimethylbenzamide |
| SMILES | C/N=C(\NCCCCCOC)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C19H32N4O2/c1-20-19(21-12-6-5-7-14-25-4)22-13-11-16-9-8-10-17(15-16)18(24)23(2)3/h8-10,15H,5-7,11-14H2,1-4H3,(H2,20,21,22) |
| InChIKey | VPMBKIMNAHCLRI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|