C21H35N5O3 — CID 111670550
tert-butyl N-[3-[[N-[2-[3-(dimethylcarbamoyl)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate (PubChem CID 111670550) has the molecular formula C21H35N5O3 and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[2-[3-(dimethylcarbamoyl)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-[2-[3-(dimethylcarbamoyl)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111670550 |
| Molecular Formula | C21H35N5O3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | tert-butyl N-[3-[[N-[2-[3-(dimethylcarbamoyl)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCCc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C21H35N5O3/c1-21(2,3)29-20(28)25-13-8-12-23-19(22-4)24-14-11-16-9-7-10-17(15-16)18(27)26(5)6/h7,9-10,15H,8,11-14H2,1-6H3,(H,25,28)(H2,22,23,24) |
| InChIKey | GNTUCUMOTDUSPC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|