C20H36IN5O2 — CID 111887074
tert-butyl N-[3-[[N-[2-[4-(dimethylamino)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111887074) has the molecular formula C20H36IN5O2 and a molecular weight of 505.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[2-[4-(dimethylamino)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-[2-[4-(dimethylamino)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111887074 |
| Molecular Formula | C20H36IN5O2 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | tert-butyl N-[3-[[N-[2-[4-(dimethylamino)phenyl]ethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)OC(C)(C)C)NCCc1ccc(N(C)C)cc1.I |
| InChI | InChI=1S/C20H35N5O2.HI/c1-20(2,3)27-19(26)24-14-7-13-22-18(21-4)23-15-12-16-8-10-17(11-9-16)25(5)6;/h8-11H,7,12-15H2,1-6H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | QUSCAIRAOIRTCM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|