C23H27N5O2 — CID 111864080
methyl 4-[2-[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]ethyl]benzoate (PubChem CID 111864080) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is methyl 4-[2-[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]ethyl]benzoate.
| Compound Name | methyl 4-[2-[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]ethyl]benzoate |
|---|---|
| PubChem CID | 111864080 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | methyl 4-[2-[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]ethyl]benzoate |
| SMILES | C/N=C(\NCCc1ccc(C(=O)OC)cc1)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C23H27N5O2/c1-24-23(25-15-12-18-4-8-20(9-5-18)22(29)30-2)26-16-13-19-6-10-21(11-7-19)28-17-3-14-27-28/h3-11,14,17H,12-13,15-16H2,1-2H3,(H2,24,25,26) |
| InChIKey | SEPWJRJTMDRYGR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|