C23H29IN6O2 — CID 111863419
4-methoxy-N-[2-[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111863419) has the molecular formula C23H29IN6O2 and a molecular weight of 548.43 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 4-methoxy-N-[2-[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111863419 |
| Molecular Formula | C23H29IN6O2 |
| Molecular Weight | 548.43 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 4-methoxy-N-[2-[[N'-methyl-N-[2-(4-pyrazol-1-ylphenyl)ethyl]carbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(OC)cc1)NCCc1ccc(-n2cccn2)cc1.I |
| InChI | InChI=1S/C23H28N6O2.HI/c1-24-23(27-16-15-25-22(30)19-6-10-21(31-2)11-7-19)26-14-12-18-4-8-20(9-5-18)29-17-3-13-28-29;/h3-11,13,17H,12,14-16H2,1-2H3,(H,25,30)(H2,24,26,27);1H |
| InChIKey | HDZFKYQVULCPHE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|