C19H17F2N3O2 — CID 41412873
4-(difluoromethoxy)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]benzamide (PubChem CID 41412873) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 41412873 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 4-(difluoromethoxy)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(-n2cccn2)cc1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H17F2N3O2/c20-19(21)26-17-8-4-15(5-9-17)18(25)22-12-10-14-2-6-16(7-3-14)24-13-1-11-23-24/h1-9,11,13,19H,10,12H2,(H,22,25) |
| InChIKey | XPWVPIJNDHKVJX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |