C16H15F2NO4 — CID 78796652
4-(difluoromethoxy)-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide (PubChem CID 78796652) has the molecular formula C16H15F2NO4 and a molecular weight of 323.30 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 78796652 |
| Molecular Formula | C16H15F2NO4 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 4-(difluoromethoxy)-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C16H15F2NO4/c17-16(18)23-12-4-2-11(3-5-12)15(22)19-8-7-10-1-6-13(20)14(21)9-10/h1-6,9,16,20-21H,7-8H2,(H,19,22) |
| InChIKey | NEDGGWXQKRMEBH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|