C16H14N2O3 — CID 78796564
4-cyano-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide (PubChem CID 78796564) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-cyano-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide.
| Compound Name | 4-cyano-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 78796564 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-cyano-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)NCCc2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C16H14N2O3/c17-10-12-1-4-13(5-2-12)16(21)18-8-7-11-3-6-14(19)15(20)9-11/h1-6,9,19-20H,7-8H2,(H,18,21) |
| InChIKey | ZMWKPLQLMDMJIQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|