C22H19NO4 — CID 177308540
2-benzoyl-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide (PubChem CID 177308540) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-benzoyl-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide.
| Compound Name | 2-benzoyl-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 177308540 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-benzoyl-N-[2-(3,4-dihydroxyphenyl)ethyl]benzamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19NO4/c24-19-11-10-15(14-20(19)25)12-13-23-22(27)18-9-5-4-8-17(18)21(26)16-6-2-1-3-7-16/h1-11,14,24-25H,12-13H2,(H,23,27) |
| InChIKey | POOWAPXBTNTSLC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|