C15H17NO4 — CID 25199546
N-[2-(3,4-dihydroxyphenyl)ethyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 25199546) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 25199546 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCc2ccc(O)c(O)c2)c(C)o1 |
| InChI | InChI=1S/C15H17NO4/c1-9-7-12(10(2)20-9)15(19)16-6-5-11-3-4-13(17)14(18)8-11/h3-4,7-8,17-18H,5-6H2,1-2H3,(H,16,19) |
| InChIKey | ZJHWBFYNGOYGDN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|