C10H14ClNO2 — CID 17165083
N-(3-chloropropyl)-2,5-dimethylfuran-3-carboxamide (PubChem CID 17165083) has the molecular formula C10H14ClNO2 and a molecular weight of 215.68 g/mol. Its IUPAC name is N-(3-chloropropyl)-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-(3-chloropropyl)-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 17165083 |
| Molecular Formula | C10H14ClNO2 |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | N-(3-chloropropyl)-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCCl)c(C)o1 |
| InChI | InChI=1S/C10H14ClNO2/c1-7-6-9(8(2)14-7)10(13)12-5-3-4-11/h6H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | AIRZGDROONCSJX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|