C13H20BrNO2 — CID 106157282
N-(5-bromo-4-methylpentyl)-2,5-dimethylfuran-3-carboxamide (PubChem CID 106157282) has the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. Its IUPAC name is N-(5-bromo-4-methylpentyl)-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-(5-bromo-4-methylpentyl)-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 106157282 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(5-bromo-4-methylpentyl)-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCC(C)CBr)c(C)o1 |
| InChI | InChI=1S/C13H20BrNO2/c1-9(8-14)5-4-6-15-13(16)12-7-10(2)17-11(12)3/h7,9H,4-6,8H2,1-3H3,(H,15,16) |
| InChIKey | QMKAKHCEAVXXJB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|