C13H16Br2INO — CID 106157956
2-bromo-N-(5-bromo-4-methylpentyl)-5-iodobenzamide (PubChem CID 106157956) has the molecular formula C13H16Br2INO and a molecular weight of 488.99 g/mol. Its IUPAC name is 2-bromo-N-(5-bromo-4-methylpentyl)-5-iodobenzamide.
| Compound Name | 2-bromo-N-(5-bromo-4-methylpentyl)-5-iodobenzamide |
|---|---|
| PubChem CID | 106157956 |
| Molecular Formula | C13H16Br2INO |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 486.86 |
| IUPAC Name | 2-bromo-N-(5-bromo-4-methylpentyl)-5-iodobenzamide |
| SMILES | CC(CBr)CCCNC(=O)c1cc(I)ccc1Br |
| InChI | InChI=1S/C13H16Br2INO/c1-9(8-14)3-2-6-17-13(18)11-7-10(16)4-5-12(11)15/h4-5,7,9H,2-3,6,8H2,1H3,(H,17,18) |
| InChIKey | CZUIFVFFWDZHME-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|