C14H22ClNO2 — CID 114145694
N-[2-(2-chloroethyl)pentyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 114145694) has the molecular formula C14H22ClNO2 and a molecular weight of 271.79 g/mol. Its IUPAC name is N-[2-(2-chloroethyl)pentyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[2-(2-chloroethyl)pentyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 114145694 |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | N-[2-(2-chloroethyl)pentyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | CCCC(CCCl)CNC(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C14H22ClNO2/c1-4-5-12(6-7-15)9-16-14(17)13-8-10(2)18-11(13)3/h8,12H,4-7,9H2,1-3H3,(H,16,17) |
| InChIKey | DJMZFSAYPYZWLX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|