C16H27N3O3 — CID 42954143
1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-(2-ethylhexyl)urea (PubChem CID 42954143) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-(2-ethylhexyl)urea.
| Compound Name | 1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-(2-ethylhexyl)urea |
|---|---|
| PubChem CID | 42954143 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-(2-ethylhexyl)urea |
| SMILES | CCCCC(CC)CNC(=O)NNC(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C16H27N3O3/c1-5-7-8-13(6-2)10-17-16(21)19-18-15(20)14-9-11(3)22-12(14)4/h9,13H,5-8,10H2,1-4H3,(H,18,20)(H2,17,19,21) |
| InChIKey | ZPGOLGPPIMSTPZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|