C15H25NO3 — CID 107816717
5-[(2-ethylhexylamino)methyl]-2-methylfuran-3-carboxylic acid (PubChem CID 107816717) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 5-[(2-ethylhexylamino)methyl]-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-[(2-ethylhexylamino)methyl]-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 107816717 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 5-[(2-ethylhexylamino)methyl]-2-methylfuran-3-carboxylic acid |
| SMILES | CCCCC(CC)CNCc1cc(C(=O)O)c(C)o1 |
| InChI | InChI=1S/C15H25NO3/c1-4-6-7-12(5-2)9-16-10-13-8-14(15(17)18)11(3)19-13/h8,12,16H,4-7,9-10H2,1-3H3,(H,17,18) |
| InChIKey | QXTKVPKFYRZGPO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |