About dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine
dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine (PubChem CID 87301269) has the molecular formula C16H37MoNO4
and a molecular weight of 403.42 g/mol. Its IUPAC name is dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine.
Molecular Properties
| Compound Name | dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine |
| PubChem CID | 87301269 |
| Molecular Formula | C16H37MoNO4 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine |
| SMILES | CCCCC(CC)CNCC(CC)CCCC.O=[Mo](=O)(O)O |
| InChI | InChI=1S/C16H35N.Mo.2H2O.2O/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2;;;;;/h15-17H,5-14H2,1-4H3;;2*1H2;;/q;+2;;;;/p-2 |
| InChIKey | XKJIHPUXCFYBJY-UHFFFAOYSA-L |
| XLogP | 3.65 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine?
The IUPAC name of dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine (CID 87301269) is dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine.
What is the SMILES notation for dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine?
The canonical SMILES for dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine is CCCCC(CC)CNCC(CC)CCCC.O=[Mo](=O)(O)O.
What is the InChIKey of dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine?
The InChIKey is XKJIHPUXCFYBJY-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H35N.Mo.2H2O.2O/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2;;;;;/h15-17H,5-14H2,1-4H3;;2*1H2;;/q;+2;;;;/p-2.
What are the key properties of dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine?
dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine has a molecular weight of 403.42 g/mol, XLogP of 3.65, 12 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(dioxo)molybdenum;2-ethyl-N-(2-ethylhexyl)hexan-1-amine is sourced from PubChem (CID 87301269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).