C15H33NO — CID 107152038
1-(2-ethylhexylamino)-4,4-dimethylpentan-2-ol (PubChem CID 107152038) has the molecular formula C15H33NO and a molecular weight of 243.43 g/mol. Its IUPAC name is 1-(2-ethylhexylamino)-4,4-dimethylpentan-2-ol.
| Compound Name | 1-(2-ethylhexylamino)-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 107152038 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 1-(2-ethylhexylamino)-4,4-dimethylpentan-2-ol |
| SMILES | CCCCC(CC)CNCC(O)CC(C)(C)C |
| InChI | InChI=1S/C15H33NO/c1-6-8-9-13(7-2)11-16-12-14(17)10-15(3,4)5/h13-14,16-17H,6-12H2,1-5H3 |
| InChIKey | LDMFMYSVJKFMQJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |