C10H23N — CID 14272988
N,2-diethylhexan-1-amine (PubChem CID 14272988) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is N,2-diethylhexan-1-amine.
| Compound Name | N,2-diethylhexan-1-amine |
|---|---|
| PubChem CID | 14272988 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | N,2-diethylhexan-1-amine |
| SMILES | CCCCC(CC)CNCC |
| InChI | InChI=1S/C10H23N/c1-4-7-8-10(5-2)9-11-6-3/h10-11H,4-9H2,1-3H3 |
| InChIKey | IQGLRXQADKZNIS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |