About magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride
magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride (PubChem CID 175293817) has the molecular formula C18H39Cl2MgN
and a molecular weight of 364.73 g/mol. Its IUPAC name is magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride.
Molecular Properties
| Compound Name | magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride |
| PubChem CID | 175293817 |
| Molecular Formula | C18H39Cl2MgN |
| Molecular Weight | 364.73 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride |
| SMILES | CCCCCC(CCC)CNCC(CC)CCCC.[Cl-].[Cl-].[Mg+2] |
| InChI | InChI=1S/C18H39N.2ClH.Mg/c1-5-9-11-14-18(12-7-3)16-19-15-17(8-4)13-10-6-2;;;/h17-19H,5-16H2,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | QMOYVTIJUPIIGR-UHFFFAOYSA-L |
| XLogP | -0.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.73 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride?
The IUPAC name of magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride (CID 175293817) is magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride.
What is the SMILES notation for magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride?
The canonical SMILES for magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride is CCCCCC(CCC)CNCC(CC)CCCC.[Cl-].[Cl-].[Mg+2].
What is the InChIKey of magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride?
The InChIKey is QMOYVTIJUPIIGR-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H39N.2ClH.Mg/c1-5-9-11-14-18(12-7-3)16-19-15-17(8-4)13-10-6-2;;;/h17-19H,5-16H2,1-4H3;2*1H;/q;;;+2/p-2.
What are the key properties of magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride?
magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride has a molecular weight of 364.73 g/mol, XLogP of -0.58, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;N-(2-ethylhexyl)-2-propylheptan-1-amine;dichloride is sourced from PubChem (CID 175293817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).