About 5-ethylnonane;5-propylnonane
5-ethylnonane;5-propylnonane (PubChem CID 157441807) has the molecular formula C23H50
and a molecular weight of 326.65 g/mol. Its IUPAC name is 5-ethylnonane;5-propylnonane.
Molecular Properties
| Compound Name | 5-ethylnonane;5-propylnonane |
| PubChem CID | 157441807 |
| Molecular Formula | C23H50 |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 326.39 |
| IUPAC Name | 5-ethylnonane;5-propylnonane |
| SMILES | CCCCC(CC)CCCC.CCCCC(CCC)CCCC |
| InChI | InChI=1S/C12H26.C11H24/c1-4-7-10-12(9-6-3)11-8-5-2;1-4-7-9-11(6-3)10-8-5-2/h12H,4-11H2,1-3H3;11H,4-10H2,1-3H3 |
| InChIKey | BRTKKODMPATMDE-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-ethylnonane;5-propylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylnonane;5-propylnonane?
The IUPAC name of 5-ethylnonane;5-propylnonane (CID 157441807) is 5-ethylnonane;5-propylnonane.
What is the SMILES notation for 5-ethylnonane;5-propylnonane?
The canonical SMILES for 5-ethylnonane;5-propylnonane is CCCCC(CC)CCCC.CCCCC(CCC)CCCC.
What is the InChIKey of 5-ethylnonane;5-propylnonane?
The InChIKey is BRTKKODMPATMDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26.C11H24/c1-4-7-10-12(9-6-3)11-8-5-2;1-4-7-9-11(6-3)10-8-5-2/h12H,4-11H2,1-3H3;11H,4-10H2,1-3H3.
What are the key properties of 5-ethylnonane;5-propylnonane?
5-ethylnonane;5-propylnonane has a molecular weight of 326.65 g/mol, XLogP of 9.18, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylnonane;5-propylnonane is sourced from PubChem (CID 157441807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).