About methane;4-propyloctane
methane;4-propyloctane (PubChem CID 160687994) has the molecular formula C13H32
and a molecular weight of 188.40 g/mol. Its IUPAC name is methane;4-propyloctane.
Molecular Properties
| Compound Name | methane;4-propyloctane |
| PubChem CID | 160687994 |
| Molecular Formula | C13H32 |
| Molecular Weight | 188.40 g/mol |
| Exact Mass | 188.25 |
| IUPAC Name | methane;4-propyloctane |
| SMILES | C.C.CCCCC(CCC)CCC |
| InChI | InChI=1S/C11H24.2CH4/c1-4-7-10-11(8-5-2)9-6-3;;/h11H,4-10H2,1-3H3;2*1H4 |
| InChIKey | RPAFSCHPHHHRGO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 188.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;4-propyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-propyloctane?
The IUPAC name of methane;4-propyloctane (CID 160687994) is methane;4-propyloctane.
What is the SMILES notation for methane;4-propyloctane?
The canonical SMILES for methane;4-propyloctane is C.C.CCCCC(CCC)CCC.
What is the InChIKey of methane;4-propyloctane?
The InChIKey is RPAFSCHPHHHRGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24.2CH4/c1-4-7-10-11(8-5-2)9-6-3;;/h11H,4-10H2,1-3H3;2*1H4.
What are the key properties of methane;4-propyloctane?
methane;4-propyloctane has a molecular weight of 188.40 g/mol, XLogP of 5.67, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-propyloctane is sourced from PubChem (CID 160687994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).