About 4,5-dipropylnonane;5-propylnonane
4,5-dipropylnonane;5-propylnonane (PubChem CID 157465342) has the molecular formula C27H58
and a molecular weight of 382.76 g/mol. Its IUPAC name is 4,5-dipropylnonane;5-propylnonane.
Molecular Properties
| Compound Name | 4,5-dipropylnonane;5-propylnonane |
| PubChem CID | 157465342 |
| Molecular Formula | C27H58 |
| Molecular Weight | 382.76 g/mol |
| Exact Mass | 382.45 |
| IUPAC Name | 4,5-dipropylnonane;5-propylnonane |
| SMILES | CCCCC(CCC)C(CCC)CCC.CCCCC(CCC)CCCC |
| InChI | InChI=1S/C15H32.C12H26/c1-5-9-13-15(12-8-4)14(10-6-2)11-7-3;1-4-7-10-12(9-6-3)11-8-5-2/h14-15H,5-13H2,1-4H3;12H,4-11H2,1-3H3 |
| InChIKey | BUKGPNWWATZHOC-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.76 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,5-dipropylnonane;5-propylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dipropylnonane;5-propylnonane?
The IUPAC name of 4,5-dipropylnonane;5-propylnonane (CID 157465342) is 4,5-dipropylnonane;5-propylnonane.
What is the SMILES notation for 4,5-dipropylnonane;5-propylnonane?
The canonical SMILES for 4,5-dipropylnonane;5-propylnonane is CCCCC(CCC)C(CCC)CCC.CCCCC(CCC)CCCC.
What is the InChIKey of 4,5-dipropylnonane;5-propylnonane?
The InChIKey is BUKGPNWWATZHOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32.C12H26/c1-5-9-13-15(12-8-4)14(10-6-2)11-7-3;1-4-7-10-12(9-6-3)11-8-5-2/h14-15H,5-13H2,1-4H3;12H,4-11H2,1-3H3.
What are the key properties of 4,5-dipropylnonane;5-propylnonane?
4,5-dipropylnonane;5-propylnonane has a molecular weight of 382.76 g/mol, XLogP of 10.59, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dipropylnonane;5-propylnonane is sourced from PubChem (CID 157465342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).