About 4,5-diethylnonane
4,5-diethylnonane (PubChem CID 21188862) has the molecular formula C13H28
and a molecular weight of 184.37 g/mol. Its IUPAC name is 4,5-diethylnonane.
Molecular Properties
| Compound Name | 4,5-diethylnonane |
| PubChem CID | 21188862 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | 4,5-diethylnonane |
| SMILES | CCCCC(CC)C(CC)CCC |
| InChI | InChI=1S/C13H28/c1-5-9-11-13(8-4)12(7-3)10-6-2/h12-13H,5-11H2,1-4H3 |
| InChIKey | RFIRMFFCBRIWFT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,5-diethylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethylnonane?
The IUPAC name of 4,5-diethylnonane (CID 21188862) is 4,5-diethylnonane.
What is the SMILES notation for 4,5-diethylnonane?
The canonical SMILES for 4,5-diethylnonane is CCCCC(CC)C(CC)CCC.
What is the InChIKey of 4,5-diethylnonane?
The InChIKey is RFIRMFFCBRIWFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28/c1-5-9-11-13(8-4)12(7-3)10-6-2/h12-13H,5-11H2,1-4H3.
What are the key properties of 4,5-diethylnonane?
4,5-diethylnonane has a molecular weight of 184.37 g/mol, XLogP of 5.03, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethylnonane is sourced from PubChem (CID 21188862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).