About 3,4-diethylheptane;ethane
3,4-diethylheptane;ethane (PubChem CID 144734225) has the molecular formula C17H42
and a molecular weight of 246.52 g/mol. Its IUPAC name is 3,4-diethylheptane;ethane.
Molecular Properties
| Compound Name | 3,4-diethylheptane;ethane |
| PubChem CID | 144734225 |
| Molecular Formula | C17H42 |
| Molecular Weight | 246.52 g/mol |
| Exact Mass | 246.33 |
| IUPAC Name | 3,4-diethylheptane;ethane |
| SMILES | CC.CC.CC.CCCC(CC)C(CC)CC |
| InChI | InChI=1S/C11H24.3C2H6/c1-5-9-11(8-4)10(6-2)7-3;3*1-2/h10-11H,5-9H2,1-4H3;3*1-2H3 |
| InChIKey | DISOJNNYBCPXGX-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.52 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3,4-diethylheptane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethylheptane;ethane?
The IUPAC name of 3,4-diethylheptane;ethane (CID 144734225) is 3,4-diethylheptane;ethane.
What is the SMILES notation for 3,4-diethylheptane;ethane?
The canonical SMILES for 3,4-diethylheptane;ethane is CC.CC.CC.CCCC(CC)C(CC)CC.
What is the InChIKey of 3,4-diethylheptane;ethane?
The InChIKey is DISOJNNYBCPXGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24.3C2H6/c1-5-9-11(8-4)10(6-2)7-3;3*1-2/h10-11H,5-9H2,1-4H3;3*1-2H3.
What are the key properties of 3,4-diethylheptane;ethane?
3,4-diethylheptane;ethane has a molecular weight of 246.52 g/mol, XLogP of 7.33, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethylheptane;ethane is sourced from PubChem (CID 144734225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).