About 6-ethyl-2,5-dimethylnonane
6-ethyl-2,5-dimethylnonane (PubChem CID 54499682) has the molecular formula C13H28
and a molecular weight of 184.37 g/mol. Its IUPAC name is 6-ethyl-2,5-dimethylnonane.
Molecular Properties
| Compound Name | 6-ethyl-2,5-dimethylnonane |
| PubChem CID | 54499682 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | 6-ethyl-2,5-dimethylnonane |
| SMILES | CCCC(CC)C(C)CCC(C)C |
| InChI | InChI=1S/C13H28/c1-6-8-13(7-2)12(5)10-9-11(3)4/h11-13H,6-10H2,1-5H3 |
| InChIKey | AKXMXSRGNKLZIY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-ethyl-2,5-dimethylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,5-dimethylnonane?
The IUPAC name of 6-ethyl-2,5-dimethylnonane (CID 54499682) is 6-ethyl-2,5-dimethylnonane.
What is the SMILES notation for 6-ethyl-2,5-dimethylnonane?
The canonical SMILES for 6-ethyl-2,5-dimethylnonane is CCCC(CC)C(C)CCC(C)C.
What is the InChIKey of 6-ethyl-2,5-dimethylnonane?
The InChIKey is AKXMXSRGNKLZIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28/c1-6-8-13(7-2)12(5)10-9-11(3)4/h11-13H,6-10H2,1-5H3.
What are the key properties of 6-ethyl-2,5-dimethylnonane?
6-ethyl-2,5-dimethylnonane has a molecular weight of 184.37 g/mol, XLogP of 4.89, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,5-dimethylnonane is sourced from PubChem (CID 54499682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).