C30H68 — CID 143978230
5,11-diethyl-2,10-dimethyl-7-propyltetradecane;ethane;propane (PubChem CID 143978230) has the molecular formula C30H68 and a molecular weight of 428.87 g/mol. Its IUPAC name is 5,11-diethyl-2,10-dimethyl-7-propyltetradecane;ethane;propane.
| Compound Name | 5,11-diethyl-2,10-dimethyl-7-propyltetradecane;ethane;propane |
|---|---|
| PubChem CID | 143978230 |
| Molecular Formula | C30H68 |
| Molecular Weight | 428.87 g/mol |
| Exact Mass | 428.53 |
| IUPAC Name | 5,11-diethyl-2,10-dimethyl-7-propyltetradecane;ethane;propane |
| SMILES | CC.CC.CCC.CCCC(CCC(C)C(CC)CCC)CC(CC)CCC(C)C |
| InChI | InChI=1S/C23H48.C3H8.2C2H6/c1-8-12-22(18-21(10-3)16-14-19(5)6)17-15-20(7)23(11-4)13-9-2;1-3-2;2*1-2/h19-23H,8-18H2,1-7H3;3H2,1-2H3;2*1-2H3 |
| InChIKey | XPQNGEGAELFCGO-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.87 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |