C13H28 — CID 57491216
3,5-diethyl-2-methyloctane (PubChem CID 57491216) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is 3,5-diethyl-2-methyloctane.
| Compound Name | 3,5-diethyl-2-methyloctane |
|---|---|
| PubChem CID | 57491216 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | 3,5-diethyl-2-methyloctane |
| SMILES | CCCC(CC)CC(CC)C(C)C |
| InChI | InChI=1S/C13H28/c1-6-9-12(7-2)10-13(8-3)11(4)5/h11-13H,6-10H2,1-5H3 |
| InChIKey | ODQLVTXRKYKCFJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |