C13H28 — CID 144657446
(6S)-6-ethyl-2,4-dimethylnonane (PubChem CID 144657446) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is (6S)-6-ethyl-2,4-dimethylnonane.
| Compound Name | (6S)-6-ethyl-2,4-dimethylnonane |
|---|---|
| PubChem CID | 144657446 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | (6S)-6-ethyl-2,4-dimethylnonane |
| SMILES | CCC[C@H](CC)CC(C)CC(C)C |
| InChI | InChI=1S/C13H28/c1-6-8-13(7-2)10-12(5)9-11(3)4/h11-13H,6-10H2,1-5H3/t12?,13-/m0/s1 |
| InChIKey | FUZVJQIIJUKBFI-ABLWVSNPSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |