About 4-ethyl-2-methylheptane;methane
4-ethyl-2-methylheptane;methane (PubChem CID 160575103) has the molecular formula C12H30
and a molecular weight of 174.37 g/mol. Its IUPAC name is 4-ethyl-2-methylheptane;methane.
Molecular Properties
| Compound Name | 4-ethyl-2-methylheptane;methane |
| PubChem CID | 160575103 |
| Molecular Formula | C12H30 |
| Molecular Weight | 174.37 g/mol |
| Exact Mass | 174.23 |
| IUPAC Name | 4-ethyl-2-methylheptane;methane |
| SMILES | C.C.CCCC(CC)CC(C)C |
| InChI | InChI=1S/C10H22.2CH4/c1-5-7-10(6-2)8-9(3)4;;/h9-10H,5-8H2,1-4H3;2*1H4 |
| InChIKey | RBASAKHBRYFLCH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 174.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-ethyl-2-methylheptane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methylheptane;methane?
The IUPAC name of 4-ethyl-2-methylheptane;methane (CID 160575103) is 4-ethyl-2-methylheptane;methane.
What is the SMILES notation for 4-ethyl-2-methylheptane;methane?
The canonical SMILES for 4-ethyl-2-methylheptane;methane is C.C.CCCC(CC)CC(C)C.
What is the InChIKey of 4-ethyl-2-methylheptane;methane?
The InChIKey is RBASAKHBRYFLCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22.2CH4/c1-5-7-10(6-2)8-9(3)4;;/h9-10H,5-8H2,1-4H3;2*1H4.
What are the key properties of 4-ethyl-2-methylheptane;methane?
4-ethyl-2-methylheptane;methane has a molecular weight of 174.37 g/mol, XLogP of 5.13, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methylheptane;methane is sourced from PubChem (CID 160575103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).