About bis(4-ethyl-2-methylhexane);2-methylbutane
bis(4-ethyl-2-methylhexane);2-methylbutane (PubChem CID 161441490) has the molecular formula C23H52
and a molecular weight of 328.67 g/mol. Its IUPAC name is bis(4-ethyl-2-methylhexane);2-methylbutane.
Molecular Properties
| Compound Name | bis(4-ethyl-2-methylhexane);2-methylbutane |
| PubChem CID | 161441490 |
| Molecular Formula | C23H52 |
| Molecular Weight | 328.67 g/mol |
| Exact Mass | 328.41 |
| IUPAC Name | bis(4-ethyl-2-methylhexane);2-methylbutane |
| SMILES | CCC(C)C.CCC(CC)CC(C)C.CCC(CC)CC(C)C |
| InChI | InChI=1S/2C9H20.C5H12/c2*1-5-9(6-2)7-8(3)4;1-4-5(2)3/h2*8-9H,5-7H2,1-4H3;5H,4H2,1-3H3 |
| InChIKey | VZIFNWLLEDVNLM-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.67 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(4-ethyl-2-methylhexane);2-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-ethyl-2-methylhexane);2-methylbutane?
The IUPAC name of bis(4-ethyl-2-methylhexane);2-methylbutane (CID 161441490) is bis(4-ethyl-2-methylhexane);2-methylbutane.
What is the SMILES notation for bis(4-ethyl-2-methylhexane);2-methylbutane?
The canonical SMILES for bis(4-ethyl-2-methylhexane);2-methylbutane is CCC(C)C.CCC(CC)CC(C)C.CCC(CC)CC(C)C.
What is the InChIKey of bis(4-ethyl-2-methylhexane);2-methylbutane?
The InChIKey is VZIFNWLLEDVNLM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H20.C5H12/c2*1-5-9(6-2)7-8(3)4;1-4-5(2)3/h2*8-9H,5-7H2,1-4H3;5H,4H2,1-3H3.
What are the key properties of bis(4-ethyl-2-methylhexane);2-methylbutane?
bis(4-ethyl-2-methylhexane);2-methylbutane has a molecular weight of 328.67 g/mol, XLogP of 8.99, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-ethyl-2-methylhexane);2-methylbutane is sourced from PubChem (CID 161441490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).