About 2-methylbutane;nickel
2-methylbutane;nickel (PubChem CID 159021520) has the molecular formula C5H12Ni
and a molecular weight of 130.84 g/mol. Its IUPAC name is 2-methylbutane;nickel.
Molecular Properties
| Compound Name | 2-methylbutane;nickel |
| PubChem CID | 159021520 |
| Molecular Formula | C5H12Ni |
| Molecular Weight | 130.84 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 2-methylbutane;nickel |
| SMILES | CCC(C)C.[Ni] |
| InChI | InChI=1S/C5H12.Ni/c1-4-5(2)3;/h5H,4H2,1-3H3; |
| InChIKey | JTTLPTHPVKMASH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.84 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylbutane;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;nickel?
The IUPAC name of 2-methylbutane;nickel (CID 159021520) is 2-methylbutane;nickel.
What is the SMILES notation for 2-methylbutane;nickel?
The canonical SMILES for 2-methylbutane;nickel is CCC(C)C.[Ni].
What is the InChIKey of 2-methylbutane;nickel?
The InChIKey is JTTLPTHPVKMASH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12.Ni/c1-4-5(2)3;/h5H,4H2,1-3H3;.
What are the key properties of 2-methylbutane;nickel?
2-methylbutane;nickel has a molecular weight of 130.84 g/mol, XLogP of 2.05, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;nickel is sourced from PubChem (CID 159021520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).