About 2-methylbutane;3-methylbutan-2-ol
2-methylbutane;3-methylbutan-2-ol (PubChem CID 87553210) has the molecular formula C10H24O
and a molecular weight of 160.30 g/mol. Its IUPAC name is 2-methylbutane;3-methylbutan-2-ol.
Molecular Properties
| Compound Name | 2-methylbutane;3-methylbutan-2-ol |
| PubChem CID | 87553210 |
| Molecular Formula | C10H24O |
| Molecular Weight | 160.30 g/mol |
| Exact Mass | 160.18 |
| IUPAC Name | 2-methylbutane;3-methylbutan-2-ol |
| SMILES | CC(C)C(C)O.CCC(C)C |
| InChI | InChI=1S/C5H12O.C5H12/c1-4(2)5(3)6;1-4-5(2)3/h4-6H,1-3H3;5H,4H2,1-3H3 |
| InChIKey | YQGYVZQQNIUQFS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylbutane;3-methylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;3-methylbutan-2-ol?
The IUPAC name of 2-methylbutane;3-methylbutan-2-ol (CID 87553210) is 2-methylbutane;3-methylbutan-2-ol.
What is the SMILES notation for 2-methylbutane;3-methylbutan-2-ol?
The canonical SMILES for 2-methylbutane;3-methylbutan-2-ol is CC(C)C(C)O.CCC(C)C.
What is the InChIKey of 2-methylbutane;3-methylbutan-2-ol?
The InChIKey is YQGYVZQQNIUQFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.C5H12/c1-4(2)5(3)6;1-4-5(2)3/h4-6H,1-3H3;5H,4H2,1-3H3.
What are the key properties of 2-methylbutane;3-methylbutan-2-ol?
2-methylbutane;3-methylbutan-2-ol has a molecular weight of 160.30 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;3-methylbutan-2-ol is sourced from PubChem (CID 87553210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).