About 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane
2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane (PubChem CID 165015674) has the molecular formula C17H40O
and a molecular weight of 260.51 g/mol. Its IUPAC name is 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane.
Molecular Properties
| Compound Name | 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane |
| PubChem CID | 165015674 |
| Molecular Formula | C17H40O |
| Molecular Weight | 260.51 g/mol |
| Exact Mass | 260.31 |
| IUPAC Name | 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane |
| SMILES | CC(C)C(C)C.CC(C)C(C)O.CCCC(C)C |
| InChI | InChI=1S/2C6H14.C5H12O/c1-5(2)6(3)4;1-4-5-6(2)3;1-4(2)5(3)6/h5-6H,1-4H3;6H,4-5H2,1-3H3;4-6H,1-3H3 |
| InChIKey | KJMYJXMKHJQUNB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane?
The IUPAC name of 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane (CID 165015674) is 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane.
What is the SMILES notation for 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane?
The canonical SMILES for 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane is CC(C)C(C)C.CC(C)C(C)O.CCCC(C)C.
What is the InChIKey of 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane?
The InChIKey is KJMYJXMKHJQUNB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H14.C5H12O/c1-5(2)6(3)4;1-4-5-6(2)3;1-4(2)5(3)6/h5-6H,1-4H3;6H,4-5H2,1-3H3;4-6H,1-3H3.
What are the key properties of 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane?
2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane has a molecular weight of 260.51 g/mol, XLogP of 5.76, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane;3-methylbutan-2-ol;2-methylpentane is sourced from PubChem (CID 165015674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).