About hexane;2-methylpentane
hexane;2-methylpentane (PubChem CID 19835603) has the molecular formula C12H28
and a molecular weight of 172.36 g/mol. Its IUPAC name is hexane;2-methylpentane.
Molecular Properties
| Compound Name | hexane;2-methylpentane |
| PubChem CID | 19835603 |
| Molecular Formula | C12H28 |
| Molecular Weight | 172.36 g/mol |
| Exact Mass | 172.22 |
| IUPAC Name | hexane;2-methylpentane |
| SMILES | CCCC(C)C.CCCCCC |
| InChI | InChI=1S/2C6H14/c1-4-5-6(2)3;1-3-5-6-4-2/h6H,4-5H2,1-3H3;3-6H2,1-2H3 |
| InChIKey | BNZBILCDCUJDPC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 172.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexane;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane;2-methylpentane?
The IUPAC name of hexane;2-methylpentane (CID 19835603) is hexane;2-methylpentane.
What is the SMILES notation for hexane;2-methylpentane?
The canonical SMILES for hexane;2-methylpentane is CCCC(C)C.CCCCCC.
What is the InChIKey of hexane;2-methylpentane?
The InChIKey is BNZBILCDCUJDPC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H14/c1-4-5-6(2)3;1-3-5-6-4-2/h6H,4-5H2,1-3H3;3-6H2,1-2H3.
What are the key properties of hexane;2-methylpentane?
hexane;2-methylpentane has a molecular weight of 172.36 g/mol, XLogP of 5.03, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexane;2-methylpentane is sourced from PubChem (CID 19835603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).