About 2-methylpentane;hydroiodide
2-methylpentane;hydroiodide (PubChem CID 160726714) has the molecular formula C6H15I
and a molecular weight of 214.09 g/mol. Its IUPAC name is 2-methylpentane;hydroiodide.
Molecular Properties
| Compound Name | 2-methylpentane;hydroiodide |
| PubChem CID | 160726714 |
| Molecular Formula | C6H15I |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 2-methylpentane;hydroiodide |
| SMILES | CCCC(C)C.I |
| InChI | InChI=1S/C6H14.HI/c1-4-5-6(2)3;/h6H,4-5H2,1-3H3;1H |
| InChIKey | JHCVKHRVMNXEIH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane;hydroiodide?
The IUPAC name of 2-methylpentane;hydroiodide (CID 160726714) is 2-methylpentane;hydroiodide.
What is the SMILES notation for 2-methylpentane;hydroiodide?
The canonical SMILES for 2-methylpentane;hydroiodide is CCCC(C)C.I.
What is the InChIKey of 2-methylpentane;hydroiodide?
The InChIKey is JHCVKHRVMNXEIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.HI/c1-4-5-6(2)3;/h6H,4-5H2,1-3H3;1H.
What are the key properties of 2-methylpentane;hydroiodide?
2-methylpentane;hydroiodide has a molecular weight of 214.09 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane;hydroiodide is sourced from PubChem (CID 160726714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).