About 2-methylpentane
2-methylpentane (PubChem CID 7892) has the molecular formula C6H14
and a molecular weight of 86.18 g/mol. Its IUPAC name is 2-methylpentane.
Molecular Properties
| Compound Name | 2-methylpentane |
| PubChem CID | 7892 |
| Molecular Formula | C6H14 |
| Molecular Weight | 86.18 g/mol |
| Exact Mass | 86.11 |
| IUPAC Name | 2-methylpentane |
| SMILES | CCCC(C)C |
| InChI | InChI=1S/C6H14/c1-4-5-6(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | AFABGHUZZDYHJO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.18 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentane?
The IUPAC name of 2-methylpentane (CID 7892) is 2-methylpentane.
What is the SMILES notation for 2-methylpentane?
The canonical SMILES for 2-methylpentane is CCCC(C)C.
What is the InChIKey of 2-methylpentane?
The InChIKey is AFABGHUZZDYHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14/c1-4-5-6(2)3/h6H,4-5H2,1-3H3.
What are the key properties of 2-methylpentane?
2-methylpentane has a molecular weight of 86.18 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentane is sourced from PubChem (CID 7892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).