About methane;2-methylpentane;propane
methane;2-methylpentane;propane (PubChem CID 161026516) has the molecular formula C13H34
and a molecular weight of 190.41 g/mol. Its IUPAC name is methane;2-methylpentane;propane.
Molecular Properties
| Compound Name | methane;2-methylpentane;propane |
| PubChem CID | 161026516 |
| Molecular Formula | C13H34 |
| Molecular Weight | 190.41 g/mol |
| Exact Mass | 190.27 |
| IUPAC Name | methane;2-methylpentane;propane |
| SMILES | C.CCC.CCC.CCCC(C)C |
| InChI | InChI=1S/C6H14.2C3H8.CH4/c1-4-5-6(2)3;2*1-3-2;/h6H,4-5H2,1-3H3;2*3H2,1-2H3;1H4 |
| InChIKey | TZAXULVNJXIAHQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 190.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;2-methylpentane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylpentane;propane?
The IUPAC name of methane;2-methylpentane;propane (CID 161026516) is methane;2-methylpentane;propane.
What is the SMILES notation for methane;2-methylpentane;propane?
The canonical SMILES for methane;2-methylpentane;propane is C.CCC.CCC.CCCC(C)C.
What is the InChIKey of methane;2-methylpentane;propane?
The InChIKey is TZAXULVNJXIAHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14.2C3H8.CH4/c1-4-5-6(2)3;2*1-3-2;/h6H,4-5H2,1-3H3;2*3H2,1-2H3;1H4.
What are the key properties of methane;2-methylpentane;propane?
methane;2-methylpentane;propane has a molecular weight of 190.41 g/mol, XLogP of 5.91, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylpentane;propane is sourced from PubChem (CID 161026516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).