C17H42 — CID 158735959
3-ethyl-2,4-dimethylpentane;methane;2-methylpentane (PubChem CID 158735959) has the molecular formula C17H42 and a molecular weight of 246.52 g/mol. Its IUPAC name is 3-ethyl-2,4-dimethylpentane;methane;2-methylpentane.
| Compound Name | 3-ethyl-2,4-dimethylpentane;methane;2-methylpentane |
|---|---|
| PubChem CID | 158735959 |
| Molecular Formula | C17H42 |
| Molecular Weight | 246.52 g/mol |
| Exact Mass | 246.33 |
| IUPAC Name | 3-ethyl-2,4-dimethylpentane;methane;2-methylpentane |
| SMILES | C.C.CCC(C(C)C)C(C)C.CCCC(C)C |
| InChI | InChI=1S/C9H20.C6H14.2CH4/c1-6-9(7(2)3)8(4)5;1-4-5-6(2)3;;/h7-9H,6H2,1-5H3;6H,4-5H2,1-3H3;2*1H4 |
| InChIKey | ILRIOAKTIPWRGG-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.52 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |